From Wikipedia, the free encyclopedia
JZL195
|
Names
|
Preferred IUPAC name
4-Nitrophenyl 4-[(3-phenoxyphenyl)methyl]piperazine-1-carboxylate
|
Identifiers
|
|
|
|
|
ChEMBL
|
|
ChemSpider
|
|
|
|
UNII
|
|
|
|
InChI=1S/C24H23N3O5/c28-24(32-22-11-9-20(10-12-22)27(29)30)26-15-13-25(14-16-26)18-19-5-4-8-23(17-19)31-21-6-2-1-3-7-21/h1-12,17H,13-16,18H2 Key: QNYRAEKLMNDRFY-UHFFFAOYSA-N
|
c1ccc(cc1)Oc2cccc(c2)CN3CCN(CC3)C(=O)Oc4ccc(cc4)[N+](=O)[O-]
|
Properties
|
|
C24H23N3O5
|
Molar mass
|
433.464 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
JZL195 is a potent inhibitor of both fatty acid amide hydrolase (FAAH) and monoacylglycerol lipase (MAGL), the primary enzymes responsible for degrading the endocannabinoids anandamide (AEA) and 2-arachidonoylglycerol (2-AG), respectively.[1]
- ^ Long JZ, Nomura DK, Vann RE, Walentiny DM, Booker L, Jin X, Burston JJ, Sim-Selley LJ, Lichtman AH, Wiley JL, Cravatt BF (December 2009). "Dual blockade of FAAH and MAGL identifies behavioral processes regulated by endocannabinoid crosstalk in vivo". Proceedings of the National Academy of Sciences of the United States of America. 106 (48): 20270–5. Bibcode:2009PNAS..10620270L. doi:10.1073/pnas.0909411106. PMC 2787168. PMID 19918051.
|
---|
Phytocannabinoids (comparison) | Cannabibutols | |
---|
Cannabichromenes | |
---|
Cannabicyclols | |
---|
Cannabidiols | |
---|
Cannabielsoins | |
---|
Cannabigerols | |
---|
Cannabiphorols | |
---|
Cannabinols | |
---|
Cannabitriols | |
---|
Cannabivarins | |
---|
Delta-3-tetrahydrocannabinols | |
---|
Delta-4-tetrahydrocannabinols | |
---|
Delta-7-tetrahydrocannabinols | |
---|
Delta-8-tetrahydrocannabinols | |
---|
Delta-9-tetrahydrocannabinols | |
---|
Delta-10-Tetrahydrocannabinols | |
---|
Delta-11-Tetrahydrocannabinols | |
---|
Miscellaneous cannabinoids | |
---|
Active metabolites | |
---|
|
---|
Endocannabinoids | |
---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
---|
Non-classical cannabinoids | |
---|
Adamantoylindoles | |
---|
Benzimidazoles | |
---|
Benzoylindoles | |
---|
Cyclohexylphenols | |
---|
Eicosanoids | |
---|
Indazole-3- carboxamides | |
---|
Indole-3-carboxamides | |
---|
Indole-3-carboxylates | |
---|
Naphthoylindazoles | |
---|
Naphthoylindoles | |
---|
Naphthoylpyrroles | |
---|
Naphthylmethylindenes | |
---|
Naphthylmethylindoles | |
---|
Phenylacetylindoles | |
---|
Pyrazolecarboxamides | |
---|
Tetramethylcyclo- propanoylindazoles | |
---|
Tetramethylcyclo- propanoylindoles | |
---|
Others | |
---|
|
---|
Allosteric CBRTooltip Cannabinoid receptor ligands | |
---|
Endocannabinoid enhancers (inactivation inhibitors) | |
---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
---|
|